C21H14N2O3 — CID 110449418
2-(2-hydroxyphenyl)-3-oxo-6-phenoxy-1H-isoindole-1-carbonitrile (PubChem CID 110449418) has the molecular formula C21H14N2O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-3-oxo-6-phenoxy-1H-isoindole-1-carbonitrile.
| Compound Name | 2-(2-hydroxyphenyl)-3-oxo-6-phenoxy-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110449418 |
| Molecular Formula | C21H14N2O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(2-hydroxyphenyl)-3-oxo-6-phenoxy-1H-isoindole-1-carbonitrile |
| SMILES | N#CC1c2cc(Oc3ccccc3)ccc2C(=O)N1c1ccccc1O |
| InChI | InChI=1S/C21H14N2O3/c22-13-19-17-12-15(26-14-6-2-1-3-7-14)10-11-16(17)21(25)23(19)18-8-4-5-9-20(18)24/h1-12,19,24H |
| InChIKey | NQBKXMUTGIOFAU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |