C29H18O4 — CID 54059446
5-[4-[4-(2-phenylethynyl)phenoxy]phenoxy]indene-1,3-dione (PubChem CID 54059446) has the molecular formula C29H18O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 5-[4-[4-(2-phenylethynyl)phenoxy]phenoxy]indene-1,3-dione.
| Compound Name | 5-[4-[4-(2-phenylethynyl)phenoxy]phenoxy]indene-1,3-dione |
|---|---|
| PubChem CID | 54059446 |
| Molecular Formula | C29H18O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 5-[4-[4-(2-phenylethynyl)phenoxy]phenoxy]indene-1,3-dione |
| SMILES | O=C1CC(=O)c2cc(Oc3ccc(Oc4ccc(C#Cc5ccccc5)cc4)cc3)ccc21 |
| InChI | InChI=1S/C29H18O4/c30-28-19-29(31)27-18-25(16-17-26(27)28)33-24-14-12-23(13-15-24)32-22-10-8-21(9-11-22)7-6-20-4-2-1-3-5-20/h1-5,8-18H,19H2 |
| InChIKey | LYPQPQYRDXESGV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|