C6H8N4O3 — CID 14437538
4-hydrazinyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 14437538) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 4-hydrazinyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 4-hydrazinyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 14437538 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 4-hydrazinyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1[nH]c(=O)nc(NN)c1C(=O)O |
| InChI | InChI=1S/C6H8N4O3/c1-2-3(5(11)12)4(10-7)9-6(13)8-2/h7H2,1H3,(H,11,12)(H2,8,9,10,13) |
| InChIKey | VUAOXVQKVZUBJC-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|