C7H6F2N2O3S — CID 43169264
4-(difluoromethylsulfanyl)-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 43169264) has the molecular formula C7H6F2N2O3S and a molecular weight of 236.20 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 4-(difluoromethylsulfanyl)-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43169264 |
| Molecular Formula | C7H6F2N2O3S |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1[nH]c(=O)nc(SC(F)F)c1C(=O)O |
| InChI | InChI=1S/C7H6F2N2O3S/c1-2-3(5(12)13)4(15-6(8)9)11-7(14)10-2/h6H,1H3,(H,12,13)(H,10,11,14) |
| InChIKey | IYAUBWPIFKBZNH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |