C31H48O3SSeSi2 — CID 14443329
Se-phenyl (E,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-eneselenoate (PubChem CID 14443329) has the molecular formula C31H48O3SSeSi2 and a molecular weight of 635.92 g/mol. Its IUPAC name is Se-phenyl (E,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-eneselenoate.
| Compound Name | Se-phenyl (E,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-eneselenoate |
|---|---|
| PubChem CID | 14443329 |
| Molecular Formula | C31H48O3SSeSi2 |
| Molecular Weight | 635.92 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | Se-phenyl (E,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-eneselenoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC(=O)[Se]c1ccccc1)C[C@@H](/C=C/Sc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H48O3SSeSi2/c1-30(2,3)37(7,8)33-25(21-22-35-27-17-13-11-14-18-27)23-26(34-38(9,10)31(4,5)6)24-29(32)36-28-19-15-12-16-20-28/h11-22,25-26H,23-24H2,1-10H3/b22-21+/t25-,26+/m1/s1 |
| InChIKey | JHHGSKWGVZWWDR-LANXJXPGSA-N |
| XLogP | 8.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.92 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|