C25H44O4SSi2 — CID 14443327
(E,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-enoic acid (PubChem CID 14443327) has the molecular formula C25H44O4SSi2 and a molecular weight of 496.86 g/mol. Its IUPAC name is (E,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-enoic acid.
| Compound Name | (E,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-enoic acid |
|---|---|
| PubChem CID | 14443327 |
| Molecular Formula | C25H44O4SSi2 |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (E,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylsulfanylhept-6-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC(=O)O)C[C@@H](/C=C/Sc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4SSi2/c1-24(2,3)31(7,8)28-20(16-17-30-22-14-12-11-13-15-22)18-21(19-23(26)27)29-32(9,10)25(4,5)6/h11-17,20-21H,18-19H2,1-10H3,(H,26,27)/b17-16+/t20-,21-/m1/s1 |
| InChIKey | OVPMOFCKWNSILD-XDRMLYOSSA-N |
| XLogP | 7.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|