C20H32O4SSi — CID 24749220
methyl (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-phenylsulfanylhept-6-enoate (PubChem CID 24749220) has the molecular formula C20H32O4SSi and a molecular weight of 396.63 g/mol. Its IUPAC name is methyl (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-phenylsulfanylhept-6-enoate.
| Compound Name | methyl (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-phenylsulfanylhept-6-enoate |
|---|---|
| PubChem CID | 24749220 |
| Molecular Formula | C20H32O4SSi |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | methyl (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-phenylsulfanylhept-6-enoate |
| SMILES | C=C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(CC(=O)OC)Sc1ccccc1 |
| InChI | InChI=1S/C20H32O4SSi/c1-8-16(21)19(24-26(6,7)20(2,3)4)17(14-18(22)23-5)25-15-12-10-9-11-13-15/h8-13,16-17,19,21H,1,14H2,2-7H3/t16-,17?,19+/m0/s1 |
| InChIKey | MSDHDCXCURIANC-LVLJQFTKSA-N |
| XLogP | 4.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|