C28H42O11SSi — CID 10963138
methyl (2R,4S,5R,6S)-4,5-diacetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 10963138) has the molecular formula C28H42O11SSi and a molecular weight of 614.79 g/mol. Its IUPAC name is methyl (2R,4S,5R,6S)-4,5-diacetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6S)-4,5-diacetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10963138 |
| Molecular Formula | C28H42O11SSi |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | methyl (2R,4S,5R,6S)-4,5-diacetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]([C@H](OC(C)=O)[C@H](O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H42O11SSi/c1-17(29)36-22-15-28(26(33)34-7,40-20-13-11-10-12-14-20)39-25(24(22)38-19(3)31)23(37-18(2)30)21(32)16-35-41(8,9)27(4,5)6/h10-14,21-25,32H,15-16H2,1-9H3/t21-,22+,23-,24-,25+,28-/m1/s1 |
| InChIKey | QOIPGQAYVGDFNN-OCCWCHBDSA-N |
| XLogP | 3.61 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|