C19H26O8S — CID 10862576
methyl (2R,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 10862576) has the molecular formula C19H26O8S and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10862576 |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl (2R,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](O)[C@@H](O)[C@H]([C@H](O)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C19H26O8S/c1-18(2)25-10-13(26-18)15(22)16-14(21)12(20)9-19(27-16,17(23)24-3)28-11-7-5-4-6-8-11/h4-8,12-16,20-22H,9-10H2,1-3H3/t12-,13+,14+,15+,16+,19+/m0/s1 |
| InChIKey | FVNCLEHARGUXDQ-YRIWUQCMSA-N |
| XLogP | 0.67 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |