C16H22O4S — CID 134939225
(6R)-6-[(2R,4R)-2,4-dihydroxypentyl]-4-phenylsulfanyloxan-2-one (PubChem CID 134939225) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is (6R)-6-[(2R,4R)-2,4-dihydroxypentyl]-4-phenylsulfanyloxan-2-one.
| Compound Name | (6R)-6-[(2R,4R)-2,4-dihydroxypentyl]-4-phenylsulfanyloxan-2-one |
|---|---|
| PubChem CID | 134939225 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (6R)-6-[(2R,4R)-2,4-dihydroxypentyl]-4-phenylsulfanyloxan-2-one |
| SMILES | C[C@@H](O)C[C@@H](O)C[C@@H]1CC(Sc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C16H22O4S/c1-11(17)7-12(18)8-13-9-15(10-16(19)20-13)21-14-5-3-2-4-6-14/h2-6,11-13,15,17-18H,7-10H2,1H3/t11-,12-,13-,15?/m1/s1 |
| InChIKey | JCGLUTPMQUQPER-OSBVZDBCSA-N |
| XLogP | 2.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |