C19H28O4S — CID 14586781
S-phenyl (2S,3R,4S)-3-hydroxy-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanethioate (PubChem CID 14586781) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is S-phenyl (2S,3R,4S)-3-hydroxy-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanethioate.
| Compound Name | S-phenyl (2S,3R,4S)-3-hydroxy-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanethioate |
|---|---|
| PubChem CID | 14586781 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | S-phenyl (2S,3R,4S)-3-hydroxy-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanethioate |
| SMILES | C[C@@H]([C@@H](O)[C@H](C)C(=O)Sc1ccccc1)[C@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C19H28O4S/c1-12-11-22-19(4,5)23-17(12)13(2)16(20)14(3)18(21)24-15-9-7-6-8-10-15/h6-10,12-14,16-17,20H,11H2,1-5H3/t12-,13+,14+,16-,17+/m1/s1 |
| InChIKey | FTRAXVPZQPTVJM-PYOKUCOHSA-N |
| XLogP | 3.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|