C21H32O4S — CID 102351018
S-phenyl (2S,3R)-11-(1,3-dioxolan-2-yl)-3-hydroxy-2-methylundecanethioate (PubChem CID 102351018) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is S-phenyl (2S,3R)-11-(1,3-dioxolan-2-yl)-3-hydroxy-2-methylundecanethioate.
| Compound Name | S-phenyl (2S,3R)-11-(1,3-dioxolan-2-yl)-3-hydroxy-2-methylundecanethioate |
|---|---|
| PubChem CID | 102351018 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | S-phenyl (2S,3R)-11-(1,3-dioxolan-2-yl)-3-hydroxy-2-methylundecanethioate |
| SMILES | C[C@H](C(=O)Sc1ccccc1)[C@H](O)CCCCCCCCC1OCCO1 |
| InChI | InChI=1S/C21H32O4S/c1-17(21(23)26-18-11-7-6-8-12-18)19(22)13-9-4-2-3-5-10-14-20-24-15-16-25-20/h6-8,11-12,17,19-20,22H,2-5,9-10,13-16H2,1H3/t17-,19+/m0/s1 |
| InChIKey | ZRDIHDQHARFJCN-PKOBYXMFSA-N |
| XLogP | 4.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|