C18H24O5S — CID 152588663
6-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]phenyl]-3-oxohexanoic acid (PubChem CID 152588663) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is 6-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]phenyl]-3-oxohexanoic acid.
| Compound Name | 6-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]phenyl]-3-oxohexanoic acid |
|---|---|
| PubChem CID | 152588663 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 6-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]phenyl]-3-oxohexanoic acid |
| SMILES | CC1(C)OCC(CSc2ccc(CCCC(=O)CC(=O)O)cc2)O1 |
| InChI | InChI=1S/C18H24O5S/c1-18(2)22-11-15(23-18)12-24-16-8-6-13(7-9-16)4-3-5-14(19)10-17(20)21/h6-9,15H,3-5,10-12H2,1-2H3,(H,20,21) |
| InChIKey | YUZPMUMKXISUTA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|