C17H26O2S — CID 102351015
S-phenyl (2S,3R)-3-hydroxy-2-methyldecanethioate (PubChem CID 102351015) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-hydroxy-2-methyldecanethioate.
| Compound Name | S-phenyl (2S,3R)-3-hydroxy-2-methyldecanethioate |
|---|---|
| PubChem CID | 102351015 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | S-phenyl (2S,3R)-3-hydroxy-2-methyldecanethioate |
| SMILES | CCCCCCC[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C17H26O2S/c1-3-4-5-6-10-13-16(18)14(2)17(19)20-15-11-8-7-9-12-15/h7-9,11-12,14,16,18H,3-6,10,13H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | KFIQIMDUIOVTRN-GOEBONIOSA-N |
| XLogP | 4.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|