C33H48O10S — CID 156636001
[(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanylcarbonyloxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 156636001) has the molecular formula C33H48O10S and a molecular weight of 636.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanylcarbonyloxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanylcarbonyloxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 156636001 |
| Molecular Formula | C33H48O10S |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanylcarbonyloxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@H](C(=O)Sc2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H48O10S/c1-30(2,3)26(35)39-18-20-21(41-27(36)31(4,5)6)22(42-28(37)32(7,8)9)23(43-29(38)33(10,11)12)24(40-20)25(34)44-19-16-14-13-15-17-19/h13-17,20-24H,18H2,1-12H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | KFRFGMIXJYTGME-SJSRKZJXSA-N |
| XLogP | 5.54 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|