C16H22O8S — CID 10872450
methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 10872450) has the molecular formula C16H22O8S and a molecular weight of 374.41 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10872450 |
| Molecular Formula | C16H22O8S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](O)[C@@H](O)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C16H22O8S/c1-23-15(22)16(25-9-5-3-2-4-6-9)7-10(18)12(20)14(24-16)13(21)11(19)8-17/h2-6,10-14,17-21H,7-8H2,1H3/t10-,11+,12+,13+,14+,16+/m0/s1 |
| InChIKey | WKHZLXPAYFFUPW-RYQQKAPKSA-N |
| XLogP | -1.13 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |