C18H24ClN3O3 — CID 1444564
1-(2-chlorophenyl)-3-[1-(morpholine-4-carbonyl)cyclohexyl]urea (PubChem CID 1444564) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[1-(morpholine-4-carbonyl)cyclohexyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[1-(morpholine-4-carbonyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 1444564 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[1-(morpholine-4-carbonyl)cyclohexyl]urea |
| SMILES | O=C(Nc1ccccc1Cl)NC1(C(=O)N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C18H24ClN3O3/c19-14-6-2-3-7-15(14)20-17(24)21-18(8-4-1-5-9-18)16(23)22-10-12-25-13-11-22/h2-3,6-7H,1,4-5,8-13H2,(H2,20,21,24) |
| InChIKey | CSJLCIQIOHGNHX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |