C14H16N2O2 — CID 14447109
2-(2-acetyl-1H-indol-3-yl)-N,N-dimethylacetamide (PubChem CID 14447109) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(2-acetyl-1H-indol-3-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(2-acetyl-1H-indol-3-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 14447109 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-(2-acetyl-1H-indol-3-yl)-N,N-dimethylacetamide |
| SMILES | CC(=O)c1[nH]c2ccccc2c1CC(=O)N(C)C |
| InChI | InChI=1S/C14H16N2O2/c1-9(17)14-11(8-13(18)16(2)3)10-6-4-5-7-12(10)15-14/h4-7,15H,8H2,1-3H3 |
| InChIKey | PASXURDORNHILI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|