C25H33NO — CID 90976096
ethane;1-(3-ethyl-1H-indol-2-yl)ethanone;6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 90976096) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is ethane;1-(3-ethyl-1H-indol-2-yl)ethanone;6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | ethane;1-(3-ethyl-1H-indol-2-yl)ethanone;6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 90976096 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | ethane;1-(3-ethyl-1H-indol-2-yl)ethanone;6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CC.CCc1c(C(C)=O)[nH]c2ccccc12.c1ccc2c(c1)CCCCC2 |
| InChI | InChI=1S/C12H13NO.C11H14.C2H6/c1-3-9-10-6-4-5-7-11(10)13-12(9)8(2)14;1-2-6-10-8-4-5-9-11(10)7-3-1;1-2/h4-7,13H,3H2,1-2H3;4-5,8-9H,1-3,6-7H2;1-2H3 |
| InChIKey | XJPHMVDWYMABFN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|