C24H33NO6 — CID 14449877
1-O,5-O-ditert-butyl 2-O-ethyl (2R,3Z,5S)-3-benzylidenepyrrolidine-1,2,5-tricarboxylate (PubChem CID 14449877) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-O,5-O-ditert-butyl 2-O-ethyl (2R,3Z,5S)-3-benzylidenepyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 1-O,5-O-ditert-butyl 2-O-ethyl (2R,3Z,5S)-3-benzylidenepyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 14449877 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-O,5-O-ditert-butyl 2-O-ethyl (2R,3Z,5S)-3-benzylidenepyrrolidine-1,2,5-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1/C(=C\c2ccccc2)C[C@@H](C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H33NO6/c1-8-29-21(27)19-17(14-16-12-10-9-11-13-16)15-18(20(26)30-23(2,3)4)25(19)22(28)31-24(5,6)7/h9-14,18-19H,8,15H2,1-7H3/b17-14-/t18-,19+/m0/s1 |
| InChIKey | HTFSPOFGPSYVFQ-PVHGLEGKSA-N |
| XLogP | 4.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|