C8H12O2 — CID 144501900
5-methoxy-2-methylcyclohexa-1,5-dien-1-ol (PubChem CID 144501900) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 5-methoxy-2-methylcyclohexa-1,5-dien-1-ol.
| Compound Name | 5-methoxy-2-methylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 144501900 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 5-methoxy-2-methylcyclohexa-1,5-dien-1-ol |
| SMILES | COC1=CC(O)=C(C)CC1 |
| InChI | InChI=1S/C8H12O2/c1-6-3-4-7(10-2)5-8(6)9/h5,9H,3-4H2,1-2H3 |
| InChIKey | BTLMNOXHQUCTNX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |