C13H15FO2 — CID 144902473
(3Z)-5-(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-trien-2-ol (PubChem CID 144902473) has the molecular formula C13H15FO2 and a molecular weight of 222.26 g/mol. Its IUPAC name is (3Z)-5-(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-5-(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 144902473 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3Z)-5-(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)C1=C(F)C=C(OC)CC1 |
| InChI | InChI=1S/C13H15FO2/c1-9(4-5-10(2)15)12-7-6-11(16-3)8-13(12)14/h4-5,8,15H,1-2,6-7H2,3H3/b5-4- |
| InChIKey | NDAVQSYFXSJZQX-PLNGDYQASA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|