C12H13FO2 — CID 144896561
4-[(3E)-4-fluoro-5-hydroxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol (PubChem CID 144896561) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 4-[(3E)-4-fluoro-5-hydroxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-[(3E)-4-fluoro-5-hydroxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 144896561 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-[(3E)-4-fluoro-5-hydroxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol |
| SMILES | C=C(/C=C(/F)C(=C)O)C1=CC=C(O)CC1 |
| InChI | InChI=1S/C12H13FO2/c1-8(7-12(13)9(2)14)10-3-5-11(15)6-4-10/h3,5,7,14-15H,1-2,4,6H2/b12-7+ |
| InChIKey | UUUHUHFDIUHLOM-KPKJPENVSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|