C18H19FO2 — CID 144896570
4-[(3E,7Z)-3-fluoro-9-hydroxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-ol (PubChem CID 144896570) has the molecular formula C18H19FO2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[(3E,7Z)-3-fluoro-9-hydroxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-[(3E,7Z)-3-fluoro-9-hydroxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 144896570 |
| Molecular Formula | C18H19FO2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-[(3E,7Z)-3-fluoro-9-hydroxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-ol |
| SMILES | C=C(O)/C=C\C(=C)C(=C)/C=C(/F)C(=C)C1=CC=C(O)CC1 |
| InChI | InChI=1S/C18H19FO2/c1-12(5-6-14(3)20)13(2)11-18(19)15(4)16-7-9-17(21)10-8-16/h5-7,9,11,20-21H,1-4,8,10H2/b6-5-,18-11+ |
| InChIKey | NIFGVIGIGSTGCL-KXXVGUNTSA-N |
| XLogP | 5.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|