C13H14F2O2 — CID 144878693
2-fluoro-4-[(3E)-4-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol (PubChem CID 144878693) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-fluoro-4-[(3E)-4-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 2-fluoro-4-[(3E)-4-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 144878693 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-fluoro-4-[(3E)-4-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]cyclohexa-1,3-dien-1-ol |
| SMILES | C=C(/C=C(/F)C(=C)OC)C1=CC(F)=C(O)CC1 |
| InChI | InChI=1S/C13H14F2O2/c1-8(6-11(14)9(2)17-3)10-4-5-13(16)12(15)7-10/h6-7,16H,1-2,4-5H2,3H3/b11-6+ |
| InChIKey | SSFFAQXWOBXWAA-IZZDOVSWSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|