C31H43F2NO — CID 144504125
6-[3,4-bis(ethenyl)phenyl]-1-[3-(1,1-difluoroethyl)phenyl]-4,4-dimethyl-6-methyliminohexan-1-one;ethane (PubChem CID 144504125) has the molecular formula C31H43F2NO and a molecular weight of 483.69 g/mol. Its IUPAC name is 6-[3,4-bis(ethenyl)phenyl]-1-[3-(1,1-difluoroethyl)phenyl]-4,4-dimethyl-6-methyliminohexan-1-one;ethane.
| Compound Name | 6-[3,4-bis(ethenyl)phenyl]-1-[3-(1,1-difluoroethyl)phenyl]-4,4-dimethyl-6-methyliminohexan-1-one;ethane |
|---|---|
| PubChem CID | 144504125 |
| Molecular Formula | C31H43F2NO |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | 6-[3,4-bis(ethenyl)phenyl]-1-[3-(1,1-difluoroethyl)phenyl]-4,4-dimethyl-6-methyliminohexan-1-one;ethane |
| SMILES | C=Cc1ccc(/C(CC(C)(C)CCC(=O)c2cccc(C(C)(F)F)c2)=N/C)cc1C=C.CC.CC |
| InChI | InChI=1S/C27H31F2NO.2C2H6/c1-7-19-12-13-21(16-20(19)8-2)24(30-6)18-26(3,4)15-14-25(31)22-10-9-11-23(17-22)27(5,28)29;2*1-2/h7-13,16-17H,1-2,14-15,18H2,3-6H3;2*1-2H3/b30-24+;; |
| InChIKey | LOMANPSFEYADSS-RNLCGDFESA-N |
| XLogP | 9.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|