C24H34O5 — CID 144504699
ethane;methyl 3-[4-(3-formyl-4-methoxyphenoxy)-3,5-dimethylphenyl]propanoate (PubChem CID 144504699) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is ethane;methyl 3-[4-(3-formyl-4-methoxyphenoxy)-3,5-dimethylphenyl]propanoate.
| Compound Name | ethane;methyl 3-[4-(3-formyl-4-methoxyphenoxy)-3,5-dimethylphenyl]propanoate |
|---|---|
| PubChem CID | 144504699 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | ethane;methyl 3-[4-(3-formyl-4-methoxyphenoxy)-3,5-dimethylphenyl]propanoate |
| SMILES | CC.CC.COC(=O)CCc1cc(C)c(Oc2ccc(OC)c(C=O)c2)c(C)c1 |
| InChI | InChI=1S/C20H22O5.2C2H6/c1-13-9-15(5-8-19(22)24-4)10-14(2)20(13)25-17-6-7-18(23-3)16(11-17)12-21;2*1-2/h6-7,9-12H,5,8H2,1-4H3;2*1-2H3 |
| InChIKey | GNTJPHNNEWQGJQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|