C35H45BN2O4Sn — CID 144506362
tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1,3λ2-benzazastannol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 144506362) has the molecular formula C35H45BN2O4Sn and a molecular weight of 687.28 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1,3λ2-benzazastannol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1,3λ2-benzazastannol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144506362 |
| Molecular Formula | C35H45BN2O4Sn |
| Molecular Weight | 687.28 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1,3λ2-benzazastannol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=Nc2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4c3CC3(CCCC3)C4)cc2[Sn]1 |
| InChI | InChI=1S/C35H45BN2O4.Sn/c1-32(2,3)40-31(39)38-20-10-11-26(38)23-37-25-14-12-24(13-15-25)27-16-17-30(36-41-33(4,5)34(6,7)42-36)29-22-35(21-28(27)29)18-8-9-19-35;/h12-14,16-17,26H,8-11,18-22H2,1-7H3;/t26-;/m0./s1 |
| InChIKey | DLRMNLFWUKZITO-SNYZSRNZSA-N |
| XLogP | 6.08 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.28 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|