C33H39BN2O4 — CID 58498824
tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58498824) has the molecular formula C33H39BN2O4 and a molecular weight of 538.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58498824 |
| Molecular Formula | C33H39BN2O4 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=Nc2ccc(-c3ccc4ccc(B5OC(C)(C)C(C)(C)O5)cc4c3)cc2C1 |
| InChI | InChI=1S/C33H39BN2O4/c1-31(2,3)38-30(37)36-16-8-9-29(36)28-20-25-18-23(13-15-27(25)35-28)22-11-10-21-12-14-26(19-24(21)17-22)34-39-32(4,5)33(6,7)40-34/h10-15,17-19,29H,8-9,16,20H2,1-7H3/t29-/m0/s1 |
| InChIKey | IDAKGTJNEWHERI-LJAQVGFWSA-N |
| XLogP | 6.83 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|