C23H32BFN2O4 — CID 157256603
tert-butyl (2S,4S)-4-fluoro-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157256603) has the molecular formula C23H32BFN2O4 and a molecular weight of 430.33 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-fluoro-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157256603 |
| Molecular Formula | C23H32BFN2O4 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C23H32BFN2O4/c1-21(2,3)29-20(28)27-13-16(25)12-19(27)18-11-14-10-15(8-9-17(14)26-18)24-30-22(4,5)23(6,7)31-24/h8-10,16,19H,11-13H2,1-7H3/t16-,19-/m0/s1 |
| InChIKey | ICYRNQYYQDMJDY-LPHOPBHVSA-N |
| XLogP | 3.96 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|