C23H33BN2O4 — CID 58315987
tert-butyl (2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58315987) has the molecular formula C23H33BN2O4 and a molecular weight of 412.34 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58315987 |
| Molecular Formula | C23H33BN2O4 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl (2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=Nc2cc(B3OC(C)(C)C(C)(C)O3)ccc2C1 |
| InChI | InChI=1S/C23H33BN2O4/c1-21(2,3)28-20(27)26-12-8-9-19(26)18-13-15-10-11-16(14-17(15)25-18)24-29-22(4,5)23(6,7)30-24/h10-11,14,19H,8-9,12-13H2,1-7H3/t19-/m0/s1 |
| InChIKey | VPDQMRRNVOSRHG-IBGZPJMESA-N |
| XLogP | 4.01 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|