C22H24N2O2 — CID 166444841
tert-butyl 2-phenylspiro[indole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 166444841) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl 2-phenylspiro[indole-3,3'-pyrrolidine]-1'-carboxylate.
| Compound Name | tert-butyl 2-phenylspiro[indole-3,3'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 166444841 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tert-butyl 2-phenylspiro[indole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C(c1ccccc1)=Nc1ccccc12 |
| InChI | InChI=1S/C22H24N2O2/c1-21(2,3)26-20(25)24-14-13-22(15-24)17-11-7-8-12-18(17)23-19(22)16-9-5-4-6-10-16/h4-12H,13-15H2,1-3H3 |
| InChIKey | NBLPYUHXFPCWLE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |