C18H17F3N2O2 — CID 622095
1,1,2'-trimethyl-7'-(trifluoromethyl)spiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one (PubChem CID 622095) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 1,1,2'-trimethyl-7'-(trifluoromethyl)spiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one.
| Compound Name | 1,1,2'-trimethyl-7'-(trifluoromethyl)spiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one |
|---|---|
| PubChem CID | 622095 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1,1,2'-trimethyl-7'-(trifluoromethyl)spiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one |
| SMILES | CC1=Nc2c(C(F)(F)F)cccc2C12C=C1N(CC2)C(=O)OC1(C)C |
| InChI | InChI=1S/C18H17F3N2O2/c1-10-17(7-8-23-13(9-17)16(2,3)25-15(23)24)11-5-4-6-12(14(11)22-10)18(19,20)21/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | YDCOFAZZLCESHB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |