C19H24N2O2 — CID 102406840
tert-butyl 4a-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate (PubChem CID 102406840) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl 4a-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl 4a-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 102406840 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl 4a-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
| SMILES | C=CCC12CCN(C(=O)OC(C)(C)C)CC1=Nc1ccccc12 |
| InChI | InChI=1S/C19H24N2O2/c1-5-10-19-11-12-21(17(22)23-18(2,3)4)13-16(19)20-15-9-7-6-8-14(15)19/h5-9H,1,10-13H2,2-4H3 |
| InChIKey | YCAQGRKCZYHMPS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|