C17H20N2O2 — CID 102406839
ethyl 9b-prop-2-enyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 102406839) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 9b-prop-2-enyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | ethyl 9b-prop-2-enyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 102406839 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl 9b-prop-2-enyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | C=CCC12CN(C(=O)OCC)CCC1=Nc1ccccc12 |
| InChI | InChI=1S/C17H20N2O2/c1-3-10-17-12-19(16(20)21-4-2)11-9-15(17)18-14-8-6-5-7-13(14)17/h3,5-8H,1,4,9-12H2,2H3 |
| InChIKey | KEAMUMPZGBPROV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|