C18H19F3N2O — CID 167106132
N-(4a-methyl-4-methylidene-2,3-dihydro-1H-carbazol-1-yl)-N-ethyl-2,2,2-trifluoroacetamide (PubChem CID 167106132) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is N-(4a-methyl-4-methylidene-2,3-dihydro-1H-carbazol-1-yl)-N-ethyl-2,2,2-trifluoroacetamide.
| Compound Name | N-(4a-methyl-4-methylidene-2,3-dihydro-1H-carbazol-1-yl)-N-ethyl-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167106132 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(4a-methyl-4-methylidene-2,3-dihydro-1H-carbazol-1-yl)-N-ethyl-2,2,2-trifluoroacetamide |
| SMILES | C=C1CCC(N(CC)C(=O)C(F)(F)F)C2=Nc3ccccc3C12C |
| InChI | InChI=1S/C18H19F3N2O/c1-4-23(16(24)18(19,20)21)14-10-9-11(2)17(3)12-7-5-6-8-13(12)22-15(14)17/h5-8,14H,2,4,9-10H2,1,3H3 |
| InChIKey | XERACKSIIQGJDJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|