C21H23IN2O — CID 6450284
N-phenyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]acetamide iodide (PubChem CID 6450284) has the molecular formula C21H23IN2O and a molecular weight of 446.33 g/mol. Its IUPAC name is N-phenyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]acetamide iodide.
| Compound Name | N-phenyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]acetamide iodide |
|---|---|
| PubChem CID | 6450284 |
| Molecular Formula | C21H23IN2O |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-phenyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]acetamide iodide |
| SMILES | CC(=O)N(/C=C/C1=[N+](C)c2ccccc2C1(C)C)c1ccccc1.[I-] |
| InChI | InChI=1S/C21H23N2O.HI/c1-16(24)23(17-10-6-5-7-11-17)15-14-20-21(2,3)18-12-8-9-13-19(18)22(20)4;/h5-15H,1-4H3;1H/q+1;/p-1 |
| InChIKey | DFSAOQCBUXBCCX-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|