C28H31BN2O2 — CID 58501731
2-[(2S)-pyrrolidin-2-yl]-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indole (PubChem CID 58501731) has the molecular formula C28H31BN2O2 and a molecular weight of 438.38 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidin-2-yl]-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indole.
| Compound Name | 2-[(2S)-pyrrolidin-2-yl]-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indole |
|---|---|
| PubChem CID | 58501731 |
| Molecular Formula | C28H31BN2O2 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-[(2S)-pyrrolidin-2-yl]-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-indole |
| SMILES | CC1(C)OB(c2ccc3cc(-c4ccc5c(c4)CC([C@@H]4CCCN4)=N5)ccc3c2)OC1(C)C |
| InChI | InChI=1S/C28H31BN2O2/c1-27(2)28(3,4)33-29(32-27)23-11-9-19-14-18(7-8-21(19)16-23)20-10-12-24-22(15-20)17-26(31-24)25-6-5-13-30-25/h7-12,14-16,25,30H,5-6,13,17H2,1-4H3/t25-/m0/s1 |
| InChIKey | KHQGXJPBGQCHEC-VWLOTQADSA-N |
| XLogP | 5.19 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|