C34H39BN2O2 — CID 144741430
1-[C-phenyl-N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbonimidoyl]-6-propylnaphthalen-2-amine (PubChem CID 144741430) has the molecular formula C34H39BN2O2 and a molecular weight of 518.51 g/mol. Its IUPAC name is 1-[C-phenyl-N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbonimidoyl]-6-propylnaphthalen-2-amine.
| Compound Name | 1-[C-phenyl-N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbonimidoyl]-6-propylnaphthalen-2-amine |
|---|---|
| PubChem CID | 144741430 |
| Molecular Formula | C34H39BN2O2 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 1-[C-phenyl-N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbonimidoyl]-6-propylnaphthalen-2-amine |
| SMILES | CCCc1ccc2c(/C(=N/C(C)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccccc3)c(N)ccc2c1 |
| InChI | InChI=1S/C34H39BN2O2/c1-7-11-24-14-20-29-27(22-24)17-21-30(36)31(29)32(26-12-9-8-10-13-26)37-23(2)25-15-18-28(19-16-25)35-38-33(3,4)34(5,6)39-35/h8-10,12-23H,7,11,36H2,1-6H3/b37-32+ |
| InChIKey | GEBAKLORWMVGOE-BQNXFWFHSA-N |
| XLogP | 7.27 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|