C27H26BFN2O2 — CID 144799251
N-(10-aminophenanthren-9-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidoyl fluoride (PubChem CID 144799251) has the molecular formula C27H26BFN2O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is N-(10-aminophenanthren-9-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidoyl fluoride.
| Compound Name | N-(10-aminophenanthren-9-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 144799251 |
| Molecular Formula | C27H26BFN2O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-(10-aminophenanthren-9-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidoyl fluoride |
| SMILES | CC1(C)OB(c2cccc(/C(F)=N/c3c(N)c4ccccc4c4ccccc34)c2)OC1(C)C |
| InChI | InChI=1S/C27H26BFN2O2/c1-26(2)27(3,4)33-28(32-26)18-11-9-10-17(16-18)25(29)31-24-22-15-8-6-13-20(22)19-12-5-7-14-21(19)23(24)30/h5-16H,30H2,1-4H3/b31-25- |
| InChIKey | OUZQZGKOONVHBI-GDWJVWIDSA-N |
| XLogP | 5.92 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|