C42H50BNO2 — CID 145334011
ethane;N-[10-propyl-3-[3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenanthren-9-yl]prop-2-en-1-imine (PubChem CID 145334011) has the molecular formula C42H50BNO2 and a molecular weight of 611.68 g/mol. Its IUPAC name is ethane;N-[10-propyl-3-[3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenanthren-9-yl]prop-2-en-1-imine.
| Compound Name | ethane;N-[10-propyl-3-[3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenanthren-9-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 145334011 |
| Molecular Formula | C42H50BNO2 |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.39 |
| IUPAC Name | ethane;N-[10-propyl-3-[3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenanthren-9-yl]prop-2-en-1-imine |
| SMILES | C=C/C=N/c1c(CCC)c2ccc(-c3cccc(-c4ccccc4B4OC(C)(C)C(C)(C)O4)c3)cc2c2ccccc12.CC.CC |
| InChI | InChI=1S/C38H38BNO2.2C2H6/c1-7-14-32-31-22-21-27(25-34(31)30-18-9-10-19-33(30)36(32)40-23-8-2)26-15-13-16-28(24-26)29-17-11-12-20-35(29)39-41-37(3,4)38(5,6)42-39;2*1-2/h8-13,15-25H,2,7,14H2,1,3-6H3;2*1-2H3/b40-23+;; |
| InChIKey | LYXIEPCQEFEKGX-SCSZRBQDSA-N |
| XLogP | 11.52 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|