About ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide
ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide (PubChem CID 144507756) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide.
Molecular Properties
| Compound Name | ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide |
| PubChem CID | 144507756 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide |
| SMILES | CC.CC1CCC(ON(C)N=O)CC1 |
| InChI | InChI=1S/C8H16N2O2.C2H6/c1-7-3-5-8(6-4-7)12-10(2)9-11;1-2/h7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | HZUCQTGSWOXJGS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide?
The IUPAC name of ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide (CID 144507756) is ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide.
What is the SMILES notation for ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide?
The canonical SMILES for ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide is CC.CC1CCC(ON(C)N=O)CC1.
What is the InChIKey of ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide?
The InChIKey is HZUCQTGSWOXJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.C2H6/c1-7-3-5-8(6-4-7)12-10(2)9-11;1-2/h7-8H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide?
ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide has a molecular weight of 202.30 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-N-(4-methylcyclohexyl)oxynitrous amide is sourced from PubChem (CID 144507756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).