C25H33F3N4O — CID 144510548
[(2S)-2-(1,7-diazaspiro[3.5]nonan-1-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 144510548) has the molecular formula C25H33F3N4O and a molecular weight of 462.56 g/mol. Its IUPAC name is [(2S)-2-(1,7-diazaspiro[3.5]nonan-1-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(2S)-2-(1,7-diazaspiro[3.5]nonan-1-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 144510548 |
| Molecular Formula | C25H33F3N4O |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(2S)-2-(1,7-diazaspiro[3.5]nonan-1-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)C12CCCC1C[C@H](N1CCC13CCNCC3)C2 |
| InChI | InChI=1S/C25H33F3N4O/c26-25(27,28)19-12-17-16-31(10-3-21(17)30-15-19)22(33)24-4-1-2-18(24)13-20(14-24)32-11-7-23(32)5-8-29-9-6-23/h12,15,18,20,29H,1-11,13-14,16H2/t18?,20-,24?/m0/s1 |
| InChIKey | NUJSDXVPSGXEQX-WLBKGHODSA-N |
| XLogP | 3.76 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |