C28H40F3N3O — CID 144510523
[2-[(2,6-diethylcyclohexyl)amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 144510523) has the molecular formula C28H40F3N3O and a molecular weight of 491.64 g/mol. Its IUPAC name is [2-[(2,6-diethylcyclohexyl)amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [2-[(2,6-diethylcyclohexyl)amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 144510523 |
| Molecular Formula | C28H40F3N3O |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | [2-[(2,6-diethylcyclohexyl)amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | CCC1CCCC(CC)C1NC1CC2CCCC2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C28H40F3N3O/c1-3-18-7-5-8-19(4-2)25(18)33-23-14-21-9-6-11-27(21,15-23)26(35)34-12-10-24-20(17-34)13-22(16-32-24)28(29,30)31/h13,16,18-19,21,23,25,33H,3-12,14-15,17H2,1-2H3 |
| InChIKey | AVDCLOVSMJCXAP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |