C28H33F3N4O2 — CID 71498248
[(3aR,6aR)-2-[[(2R,4S)-2-pyridin-2-yloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 71498248) has the molecular formula C28H33F3N4O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is [(3aR,6aR)-2-[[(2R,4S)-2-pyridin-2-yloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(3aR,6aR)-2-[[(2R,4S)-2-pyridin-2-yloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 71498248 |
| Molecular Formula | C28H33F3N4O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | [(3aR,6aR)-2-[[(2R,4S)-2-pyridin-2-yloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)[C@@]12CCC[C@@H]1CC(N[C@H]1CCO[C@@H](c3ccccn3)C1)C2 |
| InChI | InChI=1S/C28H33F3N4O2/c29-28(30,31)20-12-18-17-35(10-6-23(18)33-16-20)26(36)27-8-3-4-19(27)13-22(15-27)34-21-7-11-37-25(14-21)24-5-1-2-9-32-24/h1-2,5,9,12,16,19,21-22,25,34H,3-4,6-8,10-11,13-15,17H2/t19-,21+,22?,25-,27-/m1/s1 |
| InChIKey | XLYIYXFIXUHZDJ-IGTAGKTGSA-N |
| XLogP | 4.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |