C30H33F3N2O — CID 144510717
[(2R,3aR,7aR)-2-[(3-phenylcyclobutylidene)methyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 144510717) has the molecular formula C30H33F3N2O and a molecular weight of 494.60 g/mol. Its IUPAC name is [(2R,3aR,7aR)-2-[(3-phenylcyclobutylidene)methyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(2R,3aR,7aR)-2-[(3-phenylcyclobutylidene)methyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 144510717 |
| Molecular Formula | C30H33F3N2O |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(2R,3aR,7aR)-2-[(3-phenylcyclobutylidene)methyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)[C@@]12CCCC[C@@H]1C[C@@H](C=C1CC(c3ccccc3)C1)C2 |
| InChI | InChI=1S/C30H33F3N2O/c31-30(32,33)26-16-24-19-35(11-9-27(24)34-18-26)28(36)29-10-5-4-8-25(29)15-21(17-29)12-20-13-23(14-20)22-6-2-1-3-7-22/h1-3,6-7,12,16,18,21,23,25H,4-5,8-11,13-15,17,19H2/b20-12-/t21-,23?,25-,29-/m1/s1 |
| InChIKey | REXRQHKGFFQHSO-OILQWWFUSA-N |
| XLogP | 7.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|