C12H13NOP2 — CID 144510885
6-[4-methyl-2,6-bis(phosphanyl)phenyl]pyridin-3-ol (PubChem CID 144510885) has the molecular formula C12H13NOP2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 6-[4-methyl-2,6-bis(phosphanyl)phenyl]pyridin-3-ol.
| Compound Name | 6-[4-methyl-2,6-bis(phosphanyl)phenyl]pyridin-3-ol |
|---|---|
| PubChem CID | 144510885 |
| Molecular Formula | C12H13NOP2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 6-[4-methyl-2,6-bis(phosphanyl)phenyl]pyridin-3-ol |
| SMILES | Cc1cc(P)c(-c2ccc(O)cn2)c(P)c1 |
| InChI | InChI=1S/C12H13NOP2/c1-7-4-10(15)12(11(16)5-7)9-3-2-8(14)6-13-9/h2-6,14H,15-16H2,1H3 |
| InChIKey | HCPMTRBMHYTGSA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|