C18H28N3O3P — CID 144513048
3-cyano-N-[1-[ethoxy(methyl)phosphoryl]piperidin-4-yl]benzamide;ethane (PubChem CID 144513048) has the molecular formula C18H28N3O3P and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-cyano-N-[1-[ethoxy(methyl)phosphoryl]piperidin-4-yl]benzamide;ethane.
| Compound Name | 3-cyano-N-[1-[ethoxy(methyl)phosphoryl]piperidin-4-yl]benzamide;ethane |
|---|---|
| PubChem CID | 144513048 |
| Molecular Formula | C18H28N3O3P |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-cyano-N-[1-[ethoxy(methyl)phosphoryl]piperidin-4-yl]benzamide;ethane |
| SMILES | CC.CCOP(C)(=O)N1CCC(NC(=O)c2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C16H22N3O3P.C2H6/c1-3-22-23(2,21)19-9-7-15(8-10-19)18-16(20)14-6-4-5-13(11-14)12-17;1-2/h4-6,11,15H,3,7-10H2,1-2H3,(H,18,20);1-2H3 |
| InChIKey | HITMOJGMISJVTE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|