C27H33F3N4O — CID 144513241
(3S)-N-[(1R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]-1-[4-(trifluoromethyl)phenyl]piperidin-3-amine (PubChem CID 144513241) has the molecular formula C27H33F3N4O and a molecular weight of 486.58 g/mol. Its IUPAC name is (3S)-N-[(1R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]-1-[4-(trifluoromethyl)phenyl]piperidin-3-amine.
| Compound Name | (3S)-N-[(1R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]-1-[4-(trifluoromethyl)phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 144513241 |
| Molecular Formula | C27H33F3N4O |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (3S)-N-[(1R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]-1-[4-(trifluoromethyl)phenyl]piperidin-3-amine |
| SMILES | FC(F)(F)c1ccc(N2CCC[C@H](N[C@@H]3CCCCC3/N=C3\CC(c4ccccc4)ON3)C2)cc1 |
| InChI | InChI=1S/C27H33F3N4O/c28-27(29,30)20-12-14-22(15-13-20)34-16-6-9-21(18-34)31-23-10-4-5-11-24(23)32-26-17-25(35-33-26)19-7-2-1-3-8-19/h1-3,7-8,12-15,21,23-25,31H,4-6,9-11,16-18H2,(H,32,33)/t21-,23+,24?,25?/m0/s1 |
| InChIKey | HOABYGHVCHIFQT-ALZLXQCFSA-N |
| XLogP | 5.64 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|