C28H34N8O3 — CID 144513411
methyl N-[3-[2-[[(1R)-2-[[(3S)-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-3-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]phenyl]carbamate (PubChem CID 144513411) has the molecular formula C28H34N8O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is methyl N-[3-[2-[[(1R)-2-[[(3S)-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-3-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]phenyl]carbamate.
| Compound Name | methyl N-[3-[2-[[(1R)-2-[[(3S)-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-3-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 144513411 |
| Molecular Formula | C28H34N8O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | methyl N-[3-[2-[[(1R)-2-[[(3S)-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-3-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(-c2cnc(N[C@@H]3CCCCC3N[C@H]3CCCN(c4ccc5ncnn5c4)C3)o2)c1 |
| InChI | InChI=1S/C28H34N8O3/c1-38-28(37)33-20-7-4-6-19(14-20)25-15-29-27(39-25)34-24-10-3-2-9-23(24)32-21-8-5-13-35(16-21)22-11-12-26-30-18-31-36(26)17-22/h4,6-7,11-12,14-15,17-18,21,23-24,32H,2-3,5,8-10,13,16H2,1H3,(H,29,34)(H,33,37)/t21-,23?,24+/m0/s1 |
| InChIKey | RXPZAESOJBQOLT-FYFGAKMPSA-N |
| XLogP | 4.54 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |